C25H27N3O2S — CID 87421206
(2S)-1-cyclohexyl-2-[(6-quinolin-4-yloxy-1,3-benzothiazol-2-yl)amino]propan-2-ol (PubChem CID 87421206) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is (2S)-1-cyclohexyl-2-[(6-quinolin-4-yloxy-1,3-benzothiazol-2-yl)amino]propan-2-ol.
| Compound Name | (2S)-1-cyclohexyl-2-[(6-quinolin-4-yloxy-1,3-benzothiazol-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 87421206 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2S)-1-cyclohexyl-2-[(6-quinolin-4-yloxy-1,3-benzothiazol-2-yl)amino]propan-2-ol |
| SMILES | C[C@](O)(CC1CCCCC1)Nc1nc2ccc(Oc3ccnc4ccccc34)cc2s1 |
| InChI | InChI=1S/C25H27N3O2S/c1-25(29,16-17-7-3-2-4-8-17)28-24-27-21-12-11-18(15-23(21)31-24)30-22-13-14-26-20-10-6-5-9-19(20)22/h5-6,9-15,17,29H,2-4,7-8,16H2,1H3,(H,27,28)/t25-/m0/s1 |
| InChIKey | QNRJKVBLEGFZRA-VWLOTQADSA-N |
| XLogP | 6.73 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|