C26H20IN3O4S — CID 87422339
3-[(3-iodophenyl)methyl]-8-methyl-2-(3-methylsulfanylanilino)-6-oxopyrano[3,2-f]benzimidazole-7-carboxylic acid (PubChem CID 87422339) has the molecular formula C26H20IN3O4S and a molecular weight of 597.43 g/mol. Its IUPAC name is 3-[(3-iodophenyl)methyl]-8-methyl-2-(3-methylsulfanylanilino)-6-oxopyrano[3,2-f]benzimidazole-7-carboxylic acid.
| Compound Name | 3-[(3-iodophenyl)methyl]-8-methyl-2-(3-methylsulfanylanilino)-6-oxopyrano[3,2-f]benzimidazole-7-carboxylic acid |
|---|---|
| PubChem CID | 87422339 |
| Molecular Formula | C26H20IN3O4S |
| Molecular Weight | 597.43 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | 3-[(3-iodophenyl)methyl]-8-methyl-2-(3-methylsulfanylanilino)-6-oxopyrano[3,2-f]benzimidazole-7-carboxylic acid |
| SMILES | CSc1cccc(Nc2nc3cc4c(C)c(C(=O)O)c(=O)oc4cc3n2Cc2cccc(I)c2)c1 |
| InChI | InChI=1S/C26H20IN3O4S/c1-14-19-11-20-21(12-22(19)34-25(33)23(14)24(31)32)30(13-15-5-3-6-16(27)9-15)26(29-20)28-17-7-4-8-18(10-17)35-2/h3-12H,13H2,1-2H3,(H,28,29)(H,31,32) |
| InChIKey | CLGFXVHRXBJTAU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|