C20H20ClN5O3 — CID 87422445
[(2S)-1-[[3-(2-chloro-4-pyridinyl)-1-ethylpyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid (PubChem CID 87422445) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is [(2S)-1-[[3-(2-chloro-4-pyridinyl)-1-ethylpyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[[3-(2-chloro-4-pyridinyl)-1-ethylpyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87422445 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [(2S)-1-[[3-(2-chloro-4-pyridinyl)-1-ethylpyrazol-5-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
| SMILES | CCn1nc(-c2ccnc(Cl)c2)cc1NC(=O)[C@H](Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C20H20ClN5O3/c1-2-26-18(12-15(25-26)14-8-9-22-17(21)11-14)24-19(27)16(23-20(28)29)10-13-6-4-3-5-7-13/h3-9,11-12,16,23H,2,10H2,1H3,(H,24,27)(H,28,29)/t16-/m0/s1 |
| InChIKey | HCBWPHWPBBOAMF-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|