C12H17F4N3O2 — CID 87422712
tert-butyl N-[2-[1-(1,1,2,2-tetrafluoroethyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 87422712) has the molecular formula C12H17F4N3O2 and a molecular weight of 311.28 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(1,1,2,2-tetrafluoroethyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(1,1,2,2-tetrafluoroethyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 87422712 |
| Molecular Formula | C12H17F4N3O2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl N-[2-[1-(1,1,2,2-tetrafluoroethyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cn(C(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C12H17F4N3O2/c1-11(2,3)21-10(20)17-5-4-8-6-19(7-18-8)12(15,16)9(13)14/h6-7,9H,4-5H2,1-3H3,(H,17,20) |
| InChIKey | VCERWEIZUCKHGY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|