C9H12F8N+ — CID 87423736
1-butyl-2,2,3,3,4,4,5,5-octafluoro-1-methylpyrrolidin-1-ium (PubChem CID 87423736) has the molecular formula C9H12F8N+ and a molecular weight of 286.19 g/mol. Its IUPAC name is 1-butyl-2,2,3,3,4,4,5,5-octafluoro-1-methylpyrrolidin-1-ium.
| Compound Name | 1-butyl-2,2,3,3,4,4,5,5-octafluoro-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 87423736 |
| Molecular Formula | C9H12F8N+ |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-butyl-2,2,3,3,4,4,5,5-octafluoro-1-methylpyrrolidin-1-ium |
| SMILES | CCCC[N+]1(C)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H12F8N/c1-3-4-5-18(2)8(14,15)6(10,11)7(12,13)9(18,16)17/h3-5H2,1-2H3/q+1 |
| InChIKey | YONDCGITXJOLEW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|