About 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one
4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 87429760) has the molecular formula C18H13F6NO2
and a molecular weight of 389.30 g/mol. Its IUPAC name is 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| PubChem CID | 87429760 |
| Molecular Formula | C18H13F6NO2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(c2ccccc2C(F)(F)F)COC(=O)N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F6NO2/c1-16(11-6-2-3-7-12(11)17(19,20)21)10-27-15(26)25(16)14-9-5-4-8-13(14)18(22,23)24/h2-9H,10H2,1H3 |
| InChIKey | CBUVXKQBRKTCSM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The IUPAC name of 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (CID 87429760) is 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one is CC1(c2ccccc2C(F)(F)F)COC(=O)N1c1ccccc1C(F)(F)F.
What is the InChIKey of 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The InChIKey is CBUVXKQBRKTCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F6NO2/c1-16(11-6-2-3-7-12(11)17(19,20)21)10-27-15(26)25(16)14-9-5-4-8-13(14)18(22,23)24/h2-9H,10H2,1H3.
What are the key properties of 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one has a molecular weight of 389.30 g/mol, XLogP of 5.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 87429760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).