C18H13F6NO2 — CID 87429760
4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 87429760) has the molecular formula C18H13F6NO2 and a molecular weight of 389.30 g/mol. Its IUPAC name is 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87429760 |
| Molecular Formula | C18H13F6NO2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-methyl-3,4-bis[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(c2ccccc2C(F)(F)F)COC(=O)N1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F6NO2/c1-16(11-6-2-3-7-12(11)17(19,20)21)10-27-15(26)25(16)14-9-5-4-8-13(14)18(22,23)24/h2-9H,10H2,1H3 |
| InChIKey | CBUVXKQBRKTCSM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |