C11H14ClFN2O — CID 87430250
(2S)-2-(4-chlorophenyl)-3-(2-fluoroethylamino)propanamide (PubChem CID 87430250) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-3-(2-fluoroethylamino)propanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-3-(2-fluoroethylamino)propanamide |
|---|---|
| PubChem CID | 87430250 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-3-(2-fluoroethylamino)propanamide |
| SMILES | NC(=O)[C@H](CNCCF)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClFN2O/c12-9-3-1-8(2-4-9)10(11(14)16)7-15-6-5-13/h1-4,10,15H,5-7H2,(H2,14,16)/t10-/m1/s1 |
| InChIKey | AZHMKJZBYDXWGP-SNVBAGLBSA-N |
| XLogP | 1.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|