C15H21ClFN — CID 87141524
(2S)-2-(4-chlorophenyl)-N-(2-fluoroethyl)-4-methyl-3-methylidenepentan-1-amine (PubChem CID 87141524) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N-(2-fluoroethyl)-4-methyl-3-methylidenepentan-1-amine.
| Compound Name | (2S)-2-(4-chlorophenyl)-N-(2-fluoroethyl)-4-methyl-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 87141524 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N-(2-fluoroethyl)-4-methyl-3-methylidenepentan-1-amine |
| SMILES | C=C(C(C)C)[C@H](CNCCF)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClFN/c1-11(2)12(3)15(10-18-9-8-17)13-4-6-14(16)7-5-13/h4-7,11,15,18H,3,8-10H2,1-2H3/t15-/m0/s1 |
| InChIKey | RRRYMWDSFBXBMU-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|