C56H78S2Si2 — CID 87430751
2-[2,6-bis(5-hexylthiophen-2-yl)-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 87430751) has the molecular formula C56H78S2Si2 and a molecular weight of 871.55 g/mol. Its IUPAC name is 2-[2,6-bis(5-hexylthiophen-2-yl)-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2,6-bis(5-hexylthiophen-2-yl)-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 87430751 |
| Molecular Formula | C56H78S2Si2 |
| Molecular Weight | 871.55 g/mol |
| Exact Mass | 870.51 |
| IUPAC Name | 2-[2,6-bis(5-hexylthiophen-2-yl)-10-[2-tri(propan-2-yl)silylethynyl]anthracen-9-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCCCCCc1ccc(-c2ccc3c(C#C[Si](C(C)C)(C(C)C)C(C)C)c4cc(-c5ccc(CCCCCC)s5)ccc4c(C#C[Si](C(C)C)(C(C)C)C(C)C)c3c2)s1 |
| InChI | InChI=1S/C56H78S2Si2/c1-15-17-19-21-23-47-27-31-55(57-47)45-25-29-49-52(34-36-60(42(9)10,43(11)12)44(13)14)54-38-46(56-32-28-48(58-56)24-22-20-18-16-2)26-30-50(54)51(53(49)37-45)33-35-59(39(3)4,40(5)6)41(7)8/h25-32,37-44H,15-24H2,1-14H3 |
| InChIKey | OBTRTDGNIXNGCK-UHFFFAOYSA-N |
| XLogP | 18.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.55 |
| LogP ≤ 5 | 18.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|