C17H27N3O4S — CID 87431564
butyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-4-oxobutanoate (PubChem CID 87431564) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is butyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-4-oxobutanoate.
| Compound Name | butyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87431564 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | butyl (2S)-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-4-oxobutanoate |
| SMILES | CCCCOC(=O)[C@H](CC=O)NC(=O)N(C)Cc1csc(C(C)C)n1 |
| InChI | InChI=1S/C17H27N3O4S/c1-5-6-9-24-16(22)14(7-8-21)19-17(23)20(4)10-13-11-25-15(18-13)12(2)3/h8,11-12,14H,5-7,9-10H2,1-4H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | KXRHNPZLSOMCGW-AWEZNQCLSA-N |
| XLogP | 2.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|