C14H22BrN3O2S — CID 89111464
1-[[2-(1-bromopropan-2-yl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[(2S)-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 89111464) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 1-[[2-(1-bromopropan-2-yl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[(2S)-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | 1-[[2-(1-bromopropan-2-yl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[(2S)-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 89111464 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[[2-(1-bromopropan-2-yl)-1,3-thiazol-4-yl]methyl]-1-methyl-3-[(2S)-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(CBr)c1nc(CN(C)C(=O)N[C@H](C=O)C(C)C)cs1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-9(2)12(7-19)17-14(20)18(4)6-11-8-21-13(16-11)10(3)5-15/h7-10,12H,5-6H2,1-4H3,(H,17,20)/t10?,12-/m1/s1 |
| InChIKey | PLMJBLIVNUNPOR-TVKKRMFBSA-N |
| XLogP | 3.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|