C18H12F2O4 — CID 8743568
[2-(2,5-difluorophenyl)-2-oxoethyl] 2H-chromene-3-carboxylate (PubChem CID 8743568) has the molecular formula C18H12F2O4 and a molecular weight of 330.29 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] 2H-chromene-3-carboxylate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 8743568 |
| Molecular Formula | C18H12F2O4 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 2H-chromene-3-carboxylate |
| SMILES | O=C(OCC(=O)c1cc(F)ccc1F)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C18H12F2O4/c19-13-5-6-15(20)14(8-13)16(21)10-24-18(22)12-7-11-3-1-2-4-17(11)23-9-12/h1-8H,9-10H2 |
| InChIKey | PVDJPTZXNKWVBT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |