About dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane
dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane (PubChem CID 87439087) has the molecular formula C7H21O9PSi
and a molecular weight of 308.30 g/mol. Its IUPAC name is dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane.
Molecular Properties
| Compound Name | dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane |
| PubChem CID | 87439087 |
| Molecular Formula | C7H21O9PSi |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane |
| SMILES | CC[Si](OC)(OC)OC.COOP(=O)(O)OOC |
| InChI | InChI=1S/C5H14O3Si.C2H7O6P/c1-5-9(6-2,7-3)8-4;1-5-7-9(3,4)8-6-2/h5H2,1-4H3;1-2H3,(H,3,4) |
| InChIKey | PURLVKZFKHIDRQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane?
The IUPAC name of dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane (CID 87439087) is dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane.
What is the SMILES notation for dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane?
The canonical SMILES for dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane is CC[Si](OC)(OC)OC.COOP(=O)(O)OOC.
What is the InChIKey of dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane?
The InChIKey is PURLVKZFKHIDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O3Si.C2H7O6P/c1-5-9(6-2,7-3)8-4;1-5-7-9(3,4)8-6-2/h5H2,1-4H3;1-2H3,(H,3,4).
What are the key properties of dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane?
dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane has a molecular weight of 308.30 g/mol, XLogP of 1.13, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy hydrogen phosphate;ethyl(trimethoxy)silane is sourced from PubChem (CID 87439087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).