About bis(hexane);4-pentylheptane-2,6-dione
bis(hexane);4-pentylheptane-2,6-dione (PubChem CID 87439335) has the molecular formula C24H50O2
and a molecular weight of 370.66 g/mol. Its IUPAC name is bis(hexane);4-pentylheptane-2,6-dione.
Molecular Properties
| Compound Name | bis(hexane);4-pentylheptane-2,6-dione |
| PubChem CID | 87439335 |
| Molecular Formula | C24H50O2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.38 |
| IUPAC Name | bis(hexane);4-pentylheptane-2,6-dione |
| SMILES | CCCCCC.CCCCCC.CCCCCC(CC(C)=O)CC(C)=O |
| InChI | InChI=1S/C12H22O2.2C6H14/c1-4-5-6-7-12(8-10(2)13)9-11(3)14;2*1-3-5-6-4-2/h12H,4-9H2,1-3H3;2*3-6H2,1-2H3 |
| InChIKey | GERVPGYGHVGGSF-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(hexane);4-pentylheptane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hexane);4-pentylheptane-2,6-dione?
The IUPAC name of bis(hexane);4-pentylheptane-2,6-dione (CID 87439335) is bis(hexane);4-pentylheptane-2,6-dione.
What is the SMILES notation for bis(hexane);4-pentylheptane-2,6-dione?
The canonical SMILES for bis(hexane);4-pentylheptane-2,6-dione is CCCCCC.CCCCCC.CCCCCC(CC(C)=O)CC(C)=O.
What is the InChIKey of bis(hexane);4-pentylheptane-2,6-dione?
The InChIKey is GERVPGYGHVGGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.2C6H14/c1-4-5-6-7-12(8-10(2)13)9-11(3)14;2*1-3-5-6-4-2/h12H,4-9H2,1-3H3;2*3-6H2,1-2H3.
What are the key properties of bis(hexane);4-pentylheptane-2,6-dione?
bis(hexane);4-pentylheptane-2,6-dione has a molecular weight of 370.66 g/mol, XLogP of 8.31, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hexane);4-pentylheptane-2,6-dione is sourced from PubChem (CID 87439335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).