C26H34FN5O2 — CID 87441435
4-[[1-(cyanoamino)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87441435) has the molecular formula C26H34FN5O2 and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87441435 |
| Molecular Formula | C26H34FN5O2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-methylpropylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H34FN5O2/c1-25(2,32-9-7-31(8-10-32)21-6-4-3-5-20(21)27)23(29-16-28)30-22-18-11-17-12-19(22)15-26(13-17,14-18)24(33)34/h3-6,17-19,22H,7-15H2,1-2H3,(H,29,30)(H,33,34) |
| InChIKey | SEOPOYGQVGQIKD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|