C17H10F6N4O3 — CID 87446039
[1-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyrazol-4-yl] N-pyridin-4-ylcarbamate (PubChem CID 87446039) has the molecular formula C17H10F6N4O3 and a molecular weight of 432.28 g/mol. Its IUPAC name is [1-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyrazol-4-yl] N-pyridin-4-ylcarbamate.
| Compound Name | [1-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyrazol-4-yl] N-pyridin-4-ylcarbamate |
|---|---|
| PubChem CID | 87446039 |
| Molecular Formula | C17H10F6N4O3 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [1-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyrazol-4-yl] N-pyridin-4-ylcarbamate |
| SMILES | O=C(Nc1ccncc1)Oc1cnn(-c2ccc(OC(F)(F)F)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10F6N4O3/c18-16(19,20)14-13(29-15(28)26-10-5-7-24-8-6-10)9-25-27(14)11-1-3-12(4-2-11)30-17(21,22)23/h1-9H,(H,24,26,28) |
| InChIKey | GXXMZCMJTJQMNU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |