C23H22ClF3N4O4 — CID 87446605
[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl] N-(2,4,6-triethyl-3-nitrophenyl)carbamate (PubChem CID 87446605) has the molecular formula C23H22ClF3N4O4 and a molecular weight of 510.90 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl] N-(2,4,6-triethyl-3-nitrophenyl)carbamate.
| Compound Name | [1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl] N-(2,4,6-triethyl-3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 87446605 |
| Molecular Formula | C23H22ClF3N4O4 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | [1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl] N-(2,4,6-triethyl-3-nitrophenyl)carbamate |
| SMILES | CCc1cc(CC)c([N+](=O)[O-])c(CC)c1NC(=O)Oc1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C23H22ClF3N4O4/c1-4-13-11-14(5-2)20(31(33)34)17(6-3)19(13)29-22(32)35-18-12-28-30(21(18)23(25,26)27)16-9-7-15(24)8-10-16/h7-12H,4-6H2,1-3H3,(H,29,32) |
| InChIKey | ZAPQLSWBKNMMPH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|