C12H22O — CID 87448288
(6E)-8-ethoxy-3,6-dimethylocta-1,6-diene (PubChem CID 87448288) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (6E)-8-ethoxy-3,6-dimethylocta-1,6-diene.
| Compound Name | (6E)-8-ethoxy-3,6-dimethylocta-1,6-diene |
|---|---|
| PubChem CID | 87448288 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (6E)-8-ethoxy-3,6-dimethylocta-1,6-diene |
| SMILES | C=CC(C)CC/C(C)=C/COCC |
| InChI | InChI=1S/C12H22O/c1-5-11(3)7-8-12(4)9-10-13-6-2/h5,9,11H,1,6-8,10H2,2-4H3/b12-9+ |
| InChIKey | MGJIZORTLJBESW-FMIVXFBMSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|