C49H44F6N4O2 — CID 87450934
1-[5-(3-benzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone;1-[5-(1,3-dibenzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone (PubChem CID 87450934) has the molecular formula C49H44F6N4O2 and a molecular weight of 834.91 g/mol. Its IUPAC name is 1-[5-(3-benzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone;1-[5-(1,3-dibenzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-(3-benzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone;1-[5-(1,3-dibenzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 87450934 |
| Molecular Formula | C49H44F6N4O2 |
| Molecular Weight | 834.91 g/mol |
| Exact Mass | 834.34 |
| IUPAC Name | 1-[5-(3-benzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone;1-[5-(1,3-dibenzylpyrrolidin-3-yl)-1H-indol-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc2cc(C3(Cc4ccccc4)CCN(Cc4ccccc4)C3)ccc2[nH]1)C(F)(F)F.O=C(c1cc2cc(C3(Cc4ccccc4)CCNC3)ccc2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C28H25F3N2O.C21H19F3N2O/c29-28(30,31)26(34)25-16-22-15-23(11-12-24(22)32-25)27(17-20-7-3-1-4-8-20)13-14-33(19-27)18-21-9-5-2-6-10-21;22-21(23,24)19(27)18-11-15-10-16(6-7-17(15)26-18)20(8-9-25-13-20)12-14-4-2-1-3-5-14/h1-12,15-16,32H,13-14,17-19H2;1-7,10-11,25-26H,8-9,12-13H2 |
| InChIKey | KBBCOBJZIQWYMI-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.91 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |