C11H16N2O2 — CID 87451641
2,6-dimethyl-3,5-bis(methylamino)benzoic acid (PubChem CID 87451641) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,6-dimethyl-3,5-bis(methylamino)benzoic acid.
| Compound Name | 2,6-dimethyl-3,5-bis(methylamino)benzoic acid |
|---|---|
| PubChem CID | 87451641 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2,6-dimethyl-3,5-bis(methylamino)benzoic acid |
| SMILES | CNc1cc(NC)c(C)c(C(=O)O)c1C |
| InChI | InChI=1S/C11H16N2O2/c1-6-8(12-3)5-9(13-4)7(2)10(6)11(14)15/h5,12-13H,1-4H3,(H,14,15) |
| InChIKey | ZGTTXTRYNQHULQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |