C13H22N2O3 — CID 87453389
[(3S)-2,2-dimethyl-3-(prop-2-enylcarbamoyl)hex-5-en-3-yl]carbamic acid (PubChem CID 87453389) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(3S)-2,2-dimethyl-3-(prop-2-enylcarbamoyl)hex-5-en-3-yl]carbamic acid.
| Compound Name | [(3S)-2,2-dimethyl-3-(prop-2-enylcarbamoyl)hex-5-en-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87453389 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [(3S)-2,2-dimethyl-3-(prop-2-enylcarbamoyl)hex-5-en-3-yl]carbamic acid |
| SMILES | C=CCNC(=O)[C@@](CC=C)(NC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-6-8-13(12(3,4)5,15-11(17)18)10(16)14-9-7-2/h6-7,15H,1-2,8-9H2,3-5H3,(H,14,16)(H,17,18)/t13-/m1/s1 |
| InChIKey | ZXULSMANLLGVEL-CYBMUJFWSA-N |
| XLogP | 1.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|