C13H22N2O3 — CID 87210433
tert-butyl-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamic acid (PubChem CID 87210433) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87210433 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | tert-butyl-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamic acid |
| SMILES | C=CCNC(=O)[C@H](CC=C)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-6-8-10(11(16)14-9-7-2)15(12(17)18)13(3,4)5/h6-7,10H,1-2,8-9H2,3-5H3,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | KBYNMDUPSOTTED-JTQLQIEISA-N |
| XLogP | 2.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|