C13H22N2O3 — CID 87453390
2-methylpropyl N-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamate (PubChem CID 87453390) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-methylpropyl N-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 87453390 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-methylpropyl N-[(2S)-1-oxo-1-(prop-2-enylamino)pent-4-en-2-yl]carbamate |
| SMILES | C=CCNC(=O)[C@H](CC=C)NC(=O)OCC(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-5-7-11(12(16)14-8-6-2)15-13(17)18-9-10(3)4/h5-6,10-11H,1-2,7-9H2,3-4H3,(H,14,16)(H,15,17)/t11-/m0/s1 |
| InChIKey | BMENWHIYJNKULV-NSHDSACASA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|