C41H41NO6 — CID 87453851
2,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]pyridine (PubChem CID 87453851) has the molecular formula C41H41NO6 and a molecular weight of 643.78 g/mol. Its IUPAC name is 2,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]pyridine.
| Compound Name | 2,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]pyridine |
|---|---|
| PubChem CID | 87453851 |
| Molecular Formula | C41H41NO6 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | 2,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]pyridine |
| SMILES | c1cc(Oc2ccc(-c3ccc(OCCCCC4CO4)cc3)cc2)nc(Oc2ccc(-c3ccc(OCCCCC4CO4)cc3)cc2)c1 |
| InChI | InChI=1S/C41H41NO6/c1(6-38-28-45-38)3-26-43-34-18-10-30(11-19-34)32-14-22-36(23-15-32)47-40-8-5-9-41(42-40)48-37-24-16-33(17-25-37)31-12-20-35(21-13-31)44-27-4-2-7-39-29-46-39/h5,8-25,38-39H,1-4,6-7,26-29H2 |
| InChIKey | KNQGBJXKMPCLAY-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 74.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|