C47H56N4O6 — CID 87453417
4,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 87453417) has the molecular formula C47H56N4O6 and a molecular weight of 772.99 g/mol. Its IUPAC name is 4,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 87453417 |
| Molecular Formula | C47H56N4O6 |
| Molecular Weight | 772.99 g/mol |
| Exact Mass | 772.42 |
| IUPAC Name | 4,6-bis[4-[4-[4-(oxiran-2-yl)butoxy]phenyl]phenoxy]-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1nc(Oc2ccc(-c3ccc(OCCCCC4CO4)cc3)cc2)nc(Oc2ccc(-c3ccc(OCCCCC4CO4)cc3)cc2)n1 |
| InChI | InChI=1S/C47H56N4O6/c1-46(2,3)32-47(4,5)51-43-48-44(56-39-24-16-35(17-25-39)33-12-20-37(21-13-33)52-28-8-6-10-41-30-54-41)50-45(49-43)57-40-26-18-36(19-27-40)34-14-22-38(23-15-34)53-29-9-7-11-42-31-55-42/h12-27,41-42H,6-11,28-32H2,1-5H3,(H,48,49,50,51) |
| InChIKey | IASWOHOUTMWGNH-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.99 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|