C16H11ClF3N3O3 — CID 87457281
1-[(2-chloro-4-pyridinyl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 87457281) has the molecular formula C16H11ClF3N3O3 and a molecular weight of 385.73 g/mol. Its IUPAC name is 1-[(2-chloro-4-pyridinyl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(2-chloro-4-pyridinyl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87457281 |
| Molecular Formula | C16H11ClF3N3O3 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 1-[(2-chloro-4-pyridinyl)methyl]-3-[4-(trifluoromethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(Cc2ccnc(Cl)c2)C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11ClF3N3O3/c17-13-7-10(5-6-21-13)8-22-9-14(24)23(15(22)25)11-1-3-12(4-2-11)26-16(18,19)20/h1-7H,8-9H2 |
| InChIKey | BOTYIYMHZKRAHO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|