C12H26N3O2+ — CID 87459560
3-[2-(dimethylamino)-1,3,4-trimethyl-1,3-diazinan-1-ium-1-yl]propanoic acid (PubChem CID 87459560) has the molecular formula C12H26N3O2+ and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-1,3,4-trimethyl-1,3-diazinan-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-(dimethylamino)-1,3,4-trimethyl-1,3-diazinan-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 87459560 |
| Molecular Formula | C12H26N3O2+ |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-[2-(dimethylamino)-1,3,4-trimethyl-1,3-diazinan-1-ium-1-yl]propanoic acid |
| SMILES | CC1CC[N+](C)(CCC(=O)O)C(N(C)C)N1C |
| InChI | InChI=1S/C12H25N3O2/c1-10-6-8-15(5,9-7-11(16)17)12(13(2)3)14(10)4/h10,12H,6-9H2,1-5H3/p+1 |
| InChIKey | DZGBSOKUJDNGGZ-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|