C23H29Cl3N6O3 — CID 87459684
tert-butyl 4-[2-[2-chloro-2-[5-[(2,6-dichlorophenyl)carbamoyl]pyrimidin-4-yl]hydrazinyl]ethyl]piperidine-1-carboxylate (PubChem CID 87459684) has the molecular formula C23H29Cl3N6O3 and a molecular weight of 543.88 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-chloro-2-[5-[(2,6-dichlorophenyl)carbamoyl]pyrimidin-4-yl]hydrazinyl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-chloro-2-[5-[(2,6-dichlorophenyl)carbamoyl]pyrimidin-4-yl]hydrazinyl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87459684 |
| Molecular Formula | C23H29Cl3N6O3 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | tert-butyl 4-[2-[2-chloro-2-[5-[(2,6-dichlorophenyl)carbamoyl]pyrimidin-4-yl]hydrazinyl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNN(Cl)c2ncncc2C(=O)Nc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C23H29Cl3N6O3/c1-23(2,3)35-22(34)31-11-8-15(9-12-31)7-10-29-32(26)20-16(13-27-14-28-20)21(33)30-19-17(24)5-4-6-18(19)25/h4-6,13-15,29H,7-12H2,1-3H3,(H,30,33) |
| InChIKey | YBCXYLNVNMTWRS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|