C27H31N3O5S — CID 87460198
[3-[[1-[(3-ethoxy-4-pyridin-4-ylphenyl)methyl]piperidin-4-yl]carbamoyl]phenyl] methanesulfonate (PubChem CID 87460198) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is [3-[[1-[(3-ethoxy-4-pyridin-4-ylphenyl)methyl]piperidin-4-yl]carbamoyl]phenyl] methanesulfonate.
| Compound Name | [3-[[1-[(3-ethoxy-4-pyridin-4-ylphenyl)methyl]piperidin-4-yl]carbamoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87460198 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [3-[[1-[(3-ethoxy-4-pyridin-4-ylphenyl)methyl]piperidin-4-yl]carbamoyl]phenyl] methanesulfonate |
| SMILES | CCOc1cc(CN2CCC(NC(=O)c3cccc(OS(C)(=O)=O)c3)CC2)ccc1-c1ccncc1 |
| InChI | InChI=1S/C27H31N3O5S/c1-3-34-26-17-20(7-8-25(26)21-9-13-28-14-10-21)19-30-15-11-23(12-16-30)29-27(31)22-5-4-6-24(18-22)35-36(2,32)33/h4-10,13-14,17-18,23H,3,11-12,15-16,19H2,1-2H3,(H,29,31) |
| InChIKey | QPHRKTMOSMVPAQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|