C23H34O7 — CID 87461005
6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;5-hydroxy-4-propoxycarbonylpenta-2,4-dienoic acid;methyl prop-2-enoate (PubChem CID 87461005) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;5-hydroxy-4-propoxycarbonylpenta-2,4-dienoic acid;methyl prop-2-enoate.
| Compound Name | 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;5-hydroxy-4-propoxycarbonylpenta-2,4-dienoic acid;methyl prop-2-enoate |
|---|---|
| PubChem CID | 87461005 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;5-hydroxy-4-propoxycarbonylpenta-2,4-dienoic acid;methyl prop-2-enoate |
| SMILES | C=C1CCC2CC1C2(C)C.C=CC(=O)OC.CCCOC(=O)C(C=CC(=O)O)=CO |
| InChI | InChI=1S/C10H16.C9H12O5.C4H6O2/c1-7-4-5-8-6-9(7)10(8,2)3;1-2-5-14-9(13)7(6-10)3-4-8(11)12;1-3-4(5)6-2/h8-9H,1,4-6H2,2-3H3;3-4,6,10H,2,5H2,1H3,(H,11,12);3H,1H2,2H3 |
| InChIKey | MEIGBOHMOYXEHA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|