C16H24O7 — CID 88675628
butyl 2-methylprop-2-enoate;4-ethoxycarbonyl-5-hydroxypenta-2,4-dienoic acid (PubChem CID 88675628) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;4-ethoxycarbonyl-5-hydroxypenta-2,4-dienoic acid.
| Compound Name | butyl 2-methylprop-2-enoate;4-ethoxycarbonyl-5-hydroxypenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88675628 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | butyl 2-methylprop-2-enoate;4-ethoxycarbonyl-5-hydroxypenta-2,4-dienoic acid |
| SMILES | C=C(C)C(=O)OCCCC.CCOC(=O)C(C=CC(=O)O)=CO |
| InChI | InChI=1S/C8H10O5.C8H14O2/c1-2-13-8(12)6(5-9)3-4-7(10)11;1-4-5-6-10-8(9)7(2)3/h3-5,9H,2H2,1H3,(H,10,11);2,4-6H2,1,3H3 |
| InChIKey | KPLOIZCLRXHAAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|