C26H27Cl2N3O3S — CID 87463050
(2S)-2-[[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-2-[(3-sulfanylidenespiro[3.5]non-1-en-1-yl)amino]butanoic acid (PubChem CID 87463050) has the molecular formula C26H27Cl2N3O3S and a molecular weight of 532.49 g/mol. Its IUPAC name is (2S)-2-[[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-2-[(3-sulfanylidenespiro[3.5]non-1-en-1-yl)amino]butanoic acid.
| Compound Name | (2S)-2-[[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-2-[(3-sulfanylidenespiro[3.5]non-1-en-1-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 87463050 |
| Molecular Formula | C26H27Cl2N3O3S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | (2S)-2-[[4-[(3,5-dichloropyridine-4-carbonyl)amino]phenyl]methyl]-2-[(3-sulfanylidenespiro[3.5]non-1-en-1-yl)amino]butanoic acid |
| SMILES | CC[C@@](Cc1ccc(NC(=O)c2c(Cl)cncc2Cl)cc1)(NC1=CC(=S)C12CCCCC2)C(=O)O |
| InChI | InChI=1S/C26H27Cl2N3O3S/c1-2-26(24(33)34,31-20-12-21(35)25(20)10-4-3-5-11-25)13-16-6-8-17(9-7-16)30-23(32)22-18(27)14-29-15-19(22)28/h6-9,12,14-15,31H,2-5,10-11,13H2,1H3,(H,30,32)(H,33,34)/t26-/m0/s1 |
| InChIKey | AFTGRPIVUJTQQR-SANMLTNESA-N |
| XLogP | 6.22 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|