C22H19F5N2O4S2 — CID 87463917
4-(3,4-dimethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole (PubChem CID 87463917) has the molecular formula C22H19F5N2O4S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 87463917 |
| Molecular Formula | C22H19F5N2O4S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonylpiperidin-1-yl]-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(N3CCC(S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)CC3)n2)cc1OC |
| InChI | InChI=1S/C22H19F5N2O4S2/c1-32-14-4-3-11(9-15(14)33-2)13-10-34-22(28-13)29-7-5-12(6-8-29)35(30,31)21-19(26)17(24)16(23)18(25)20(21)27/h3-4,9-10,12H,5-8H2,1-2H3 |
| InChIKey | LSSBZPOTXLGYFH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|