C8H10F3NO4 — CID 87464062
(1-morpholin-4-yl-2-oxoethyl) 2,2,2-trifluoroacetate (PubChem CID 87464062) has the molecular formula C8H10F3NO4 and a molecular weight of 241.16 g/mol. Its IUPAC name is (1-morpholin-4-yl-2-oxoethyl) 2,2,2-trifluoroacetate.
| Compound Name | (1-morpholin-4-yl-2-oxoethyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87464062 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (1-morpholin-4-yl-2-oxoethyl) 2,2,2-trifluoroacetate |
| SMILES | O=CC(OC(=O)C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C8H10F3NO4/c9-8(10,11)7(14)16-6(5-13)12-1-3-15-4-2-12/h5-6H,1-4H2 |
| InChIKey | GTVAECVPDCAJND-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|