C18H34O2S — CID 87466818
2-(3-dodecyl-1,4-oxathian-3-yl)acetaldehyde (PubChem CID 87466818) has the molecular formula C18H34O2S and a molecular weight of 314.54 g/mol. Its IUPAC name is 2-(3-dodecyl-1,4-oxathian-3-yl)acetaldehyde.
| Compound Name | 2-(3-dodecyl-1,4-oxathian-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 87466818 |
| Molecular Formula | C18H34O2S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | 2-(3-dodecyl-1,4-oxathian-3-yl)acetaldehyde |
| SMILES | CCCCCCCCCCCCC1(CC=O)COCCS1 |
| InChI | InChI=1S/C18H34O2S/c1-2-3-4-5-6-7-8-9-10-11-12-18(13-14-19)17-20-15-16-21-18/h14H,2-13,15-17H2,1H3 |
| InChIKey | RASSLTFVTUGHGA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|