C13H20N2 — CID 87467854
(E)-N,5-dimethyl-6-pyridin-3-ylhex-5-en-2-amine (PubChem CID 87467854) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (E)-N,5-dimethyl-6-pyridin-3-ylhex-5-en-2-amine.
| Compound Name | (E)-N,5-dimethyl-6-pyridin-3-ylhex-5-en-2-amine |
|---|---|
| PubChem CID | 87467854 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (E)-N,5-dimethyl-6-pyridin-3-ylhex-5-en-2-amine |
| SMILES | CNC(C)CC/C(C)=C/c1cccnc1 |
| InChI | InChI=1S/C13H20N2/c1-11(6-7-12(2)14-3)9-13-5-4-8-15-10-13/h4-5,8-10,12,14H,6-7H2,1-3H3/b11-9+ |
| InChIKey | HUGUNCUQATWKMX-PKNBQFBNSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |