C13H24O6 — CID 87468625
4-oxo-4-[1-(1-propan-2-yloxypropan-2-yloxy)propan-2-yloxy]butanoic acid (PubChem CID 87468625) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-oxo-4-[1-(1-propan-2-yloxypropan-2-yloxy)propan-2-yloxy]butanoic acid.
| Compound Name | 4-oxo-4-[1-(1-propan-2-yloxypropan-2-yloxy)propan-2-yloxy]butanoic acid |
|---|---|
| PubChem CID | 87468625 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-oxo-4-[1-(1-propan-2-yloxypropan-2-yloxy)propan-2-yloxy]butanoic acid |
| SMILES | CC(C)OCC(C)OCC(C)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C13H24O6/c1-9(2)17-7-10(3)18-8-11(4)19-13(16)6-5-12(14)15/h9-11H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | OFOPDNROPIGOLL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |