C29H27NOS4 — CID 87469992
phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate (PubChem CID 87469992) has the molecular formula C29H27NOS4 and a molecular weight of 533.81 g/mol. Its IUPAC name is phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate.
| Compound Name | phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate |
|---|---|
| PubChem CID | 87469992 |
| Molecular Formula | C29H27NOS4 |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate |
| SMILES | CCc1ccc(/N=C(/CC(SSc2ccccc2)SSc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NOS4/c1-2-23-18-20-24(21-19-23)30-28(31-25-12-6-3-7-13-25)22-29(34-32-26-14-8-4-9-15-26)35-33-27-16-10-5-11-17-27/h3-21,29H,2,22H2,1H3/b30-28- |
| InChIKey | RHUSKDHYLXBCCT-HYOGKJQXSA-N |
| XLogP | 9.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|