About phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate
phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate (PubChem CID 87469992) has the molecular formula C29H27NOS4
and a molecular weight of 533.81 g/mol. Its IUPAC name is phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate.
Molecular Properties
| Compound Name | phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate |
| PubChem CID | 87469992 |
| Molecular Formula | C29H27NOS4 |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate |
| SMILES | CCc1ccc(/N=C(/CC(SSc2ccccc2)SSc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NOS4/c1-2-23-18-20-24(21-19-23)30-28(31-25-12-6-3-7-13-25)22-29(34-32-26-14-8-4-9-15-26)35-33-27-16-10-5-11-17-27/h3-21,29H,2,22H2,1H3/b30-28- |
| InChIKey | RHUSKDHYLXBCCT-HYOGKJQXSA-N |
| XLogP | 9.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate?
The IUPAC name of phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate (CID 87469992) is phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate.
What is the SMILES notation for phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate?
The canonical SMILES for phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate is CCc1ccc(/N=C(/CC(SSc2ccccc2)SSc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate?
The InChIKey is RHUSKDHYLXBCCT-HYOGKJQXSA-N. The full InChI is InChI=1S/C29H27NOS4/c1-2-23-18-20-24(21-19-23)30-28(31-25-12-6-3-7-13-25)22-29(34-32-26-14-8-4-9-15-26)35-33-27-16-10-5-11-17-27/h3-21,29H,2,22H2,1H3/b30-28-.
What are the key properties of phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate?
phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate has a molecular weight of 533.81 g/mol, XLogP of 9.96, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(4-ethylphenyl)-3,3-bis(phenyldisulfanyl)propanimidate is sourced from PubChem (CID 87469992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).