C11H26N2O4S2 — CID 87470655
[diethylamino(propylsulfanyl)methylidene]-dimethylazanium;methyl sulfate (PubChem CID 87470655) has the molecular formula C11H26N2O4S2 and a molecular weight of 314.47 g/mol. Its IUPAC name is [diethylamino(propylsulfanyl)methylidene]-dimethylazanium;methyl sulfate.
| Compound Name | [diethylamino(propylsulfanyl)methylidene]-dimethylazanium;methyl sulfate |
|---|---|
| PubChem CID | 87470655 |
| Molecular Formula | C11H26N2O4S2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [diethylamino(propylsulfanyl)methylidene]-dimethylazanium;methyl sulfate |
| SMILES | CCCSC(N(CC)CC)=[N+](C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H23N2S.CH4O4S/c1-6-9-13-10(11(4)5)12(7-2)8-3;1-5-6(2,3)4/h6-9H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | NPNZGKWCXWPCTN-UHFFFAOYSA-M |
| XLogP | 1.19 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|