About [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate
[dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate (PubChem CID 86645099) has the molecular formula C8H20N2O4S2
and a molecular weight of 272.39 g/mol. Its IUPAC name is [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate.
Molecular Properties
| Compound Name | [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate |
| PubChem CID | 86645099 |
| Molecular Formula | C8H20N2O4S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CSC(N(C)C)=[N+](C)C |
| InChI | InChI=1S/C6H15N2S.C2H6O4S/c1-7(2)6(9-5)8(3)4;1-2-6-7(3,4)5/h1-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | IPFCAIGNIVGHMV-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate?
The IUPAC name of [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate (CID 86645099) is [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate.
What is the SMILES notation for [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate?
The canonical SMILES for [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate is CCOS(=O)(=O)[O-].CSC(N(C)C)=[N+](C)C.
What is the InChIKey of [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate?
The InChIKey is IPFCAIGNIVGHMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15N2S.C2H6O4S/c1-7(2)6(9-5)8(3)4;1-2-6-7(3,4)5/h1-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate?
[dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate has a molecular weight of 272.39 g/mol, XLogP of 0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethylamino(methylsulfanyl)methylidene]-dimethylazanium;ethyl sulfate is sourced from PubChem (CID 86645099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).