About 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid
2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid (PubChem CID 87471392) has the molecular formula C12H26N2OS
and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid.
Molecular Properties
| Compound Name | 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid |
| PubChem CID | 87471392 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid |
| SMILES | CC(C)N(CCCN(C)CC(=O)S)C(C)C |
| InChI | InChI=1S/C12H26N2OS/c1-10(2)14(11(3)4)8-6-7-13(5)9-12(15)16/h10-11H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | HLKOAWVUYFBLJE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid?
The IUPAC name of 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid (CID 87471392) is 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid.
What is the SMILES notation for 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid?
The canonical SMILES for 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid is CC(C)N(CCCN(C)CC(=O)S)C(C)C.
What is the InChIKey of 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid?
The InChIKey is HLKOAWVUYFBLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2OS/c1-10(2)14(11(3)4)8-6-7-13(5)9-12(15)16/h10-11H,6-9H2,1-5H3,(H,15,16).
What are the key properties of 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid?
2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid has a molecular weight of 246.42 g/mol, XLogP of 1.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[di(propan-2-yl)amino]propyl-methylamino]ethanethioic S-acid is sourced from PubChem (CID 87471392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).