C4H8O3 — CID 87473707
(Z)-2-methoxyprop-1-ene-1,3-diol (PubChem CID 87473707) has the molecular formula C4H8O3 and a molecular weight of 104.10 g/mol. Its IUPAC name is (Z)-2-methoxyprop-1-ene-1,3-diol.
| Compound Name | (Z)-2-methoxyprop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 87473707 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.10 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | (Z)-2-methoxyprop-1-ene-1,3-diol |
| SMILES | CO/C(=C\O)CO |
| InChI | InChI=1S/C4H8O3/c1-7-4(2-5)3-6/h2,5-6H,3H2,1H3/b4-2- |
| InChIKey | ILGXJZFBUPFBLT-RQOWECAXSA-N |
| XLogP | 0.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.10 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|