C9H14O2 — CID 15417235
(3E)-4-methoxy-2-methylidenehepta-3,6-dien-1-ol (PubChem CID 15417235) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3E)-4-methoxy-2-methylidenehepta-3,6-dien-1-ol.
| Compound Name | (3E)-4-methoxy-2-methylidenehepta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 15417235 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (3E)-4-methoxy-2-methylidenehepta-3,6-dien-1-ol |
| SMILES | C=CC/C(=C\C(=C)CO)OC |
| InChI | InChI=1S/C9H14O2/c1-4-5-9(11-3)6-8(2)7-10/h4,6,10H,1-2,5,7H2,3H3/b9-6+ |
| InChIKey | CQRIUQRTZGXVPO-RMKNXTFCSA-N |
| XLogP | 1.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|