About propyl phosphate;bis(tetrahexylphosphanium)
propyl phosphate;bis(tetrahexylphosphanium) (PubChem CID 87474397) has the molecular formula C51H111O4P3
and a molecular weight of 881.37 g/mol. Its IUPAC name is propyl phosphate;bis(tetrahexylphosphanium).
Molecular Properties
| Compound Name | propyl phosphate;bis(tetrahexylphosphanium) |
| PubChem CID | 87474397 |
| Molecular Formula | C51H111O4P3 |
| Molecular Weight | 881.37 g/mol |
| Exact Mass | 880.77 |
| IUPAC Name | propyl phosphate;bis(tetrahexylphosphanium) |
| SMILES | CCCCCC[P+](CCCCCC)(CCCCCC)CCCCCC.CCCCCC[P+](CCCCCC)(CCCCCC)CCCCCC.CCCOP(=O)([O-])[O-] |
| InChI | InChI=1S/2C24H52P.C3H9O4P/c2*1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-2-3-7-8(4,5)6/h2*5-24H2,1-4H3;2-3H2,1H3,(H2,4,5,6)/q2*+1;/p-2 |
| InChIKey | UZHIVWVFEGHEDY-UHFFFAOYSA-L |
| XLogP | 17.89 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 881.37 |
| LogP ≤ 5 | 17.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propyl phosphate;bis(tetrahexylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl phosphate;bis(tetrahexylphosphanium)?
The IUPAC name of propyl phosphate;bis(tetrahexylphosphanium) (CID 87474397) is propyl phosphate;bis(tetrahexylphosphanium).
What is the SMILES notation for propyl phosphate;bis(tetrahexylphosphanium)?
The canonical SMILES for propyl phosphate;bis(tetrahexylphosphanium) is CCCCCC[P+](CCCCCC)(CCCCCC)CCCCCC.CCCCCC[P+](CCCCCC)(CCCCCC)CCCCCC.CCCOP(=O)([O-])[O-].
What is the InChIKey of propyl phosphate;bis(tetrahexylphosphanium)?
The InChIKey is UZHIVWVFEGHEDY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C24H52P.C3H9O4P/c2*1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-2-3-7-8(4,5)6/h2*5-24H2,1-4H3;2-3H2,1H3,(H2,4,5,6)/q2*+1;/p-2.
What are the key properties of propyl phosphate;bis(tetrahexylphosphanium)?
propyl phosphate;bis(tetrahexylphosphanium) has a molecular weight of 881.37 g/mol, XLogP of 17.89, 43 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl phosphate;bis(tetrahexylphosphanium) is sourced from PubChem (CID 87474397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).