About S-cyclohexyl 3-sulfanylbutanethioate
S-cyclohexyl 3-sulfanylbutanethioate (PubChem CID 87474709) has the molecular formula C10H18OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is S-cyclohexyl 3-sulfanylbutanethioate.
Molecular Properties
| Compound Name | S-cyclohexyl 3-sulfanylbutanethioate |
| PubChem CID | 87474709 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | S-cyclohexyl 3-sulfanylbutanethioate |
| SMILES | CC(S)CC(=O)SC1CCCCC1 |
| InChI | InChI=1S/C10H18OS2/c1-8(12)7-10(11)13-9-5-3-2-4-6-9/h8-9,12H,2-7H2,1H3 |
| InChIKey | GZORDPGNDKCNOH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-cyclohexyl 3-sulfanylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyclohexyl 3-sulfanylbutanethioate?
The IUPAC name of S-cyclohexyl 3-sulfanylbutanethioate (CID 87474709) is S-cyclohexyl 3-sulfanylbutanethioate.
What is the SMILES notation for S-cyclohexyl 3-sulfanylbutanethioate?
The canonical SMILES for S-cyclohexyl 3-sulfanylbutanethioate is CC(S)CC(=O)SC1CCCCC1.
What is the InChIKey of S-cyclohexyl 3-sulfanylbutanethioate?
The InChIKey is GZORDPGNDKCNOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS2/c1-8(12)7-10(11)13-9-5-3-2-4-6-9/h8-9,12H,2-7H2,1H3.
What are the key properties of S-cyclohexyl 3-sulfanylbutanethioate?
S-cyclohexyl 3-sulfanylbutanethioate has a molecular weight of 218.39 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyclohexyl 3-sulfanylbutanethioate is sourced from PubChem (CID 87474709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).