C14H24S4 — CID 76563943
1,2-bis(cyclohexylsulfanyl)ethene-1,2-dithiol (PubChem CID 76563943) has the molecular formula C14H24S4 and a molecular weight of 320.61 g/mol. Its IUPAC name is 1,2-bis(cyclohexylsulfanyl)ethene-1,2-dithiol.
| Compound Name | 1,2-bis(cyclohexylsulfanyl)ethene-1,2-dithiol |
|---|---|
| PubChem CID | 76563943 |
| Molecular Formula | C14H24S4 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1,2-bis(cyclohexylsulfanyl)ethene-1,2-dithiol |
| SMILES | SC(SC1CCCCC1)=C(S)SC1CCCCC1 |
| InChI | InChI=1S/C14H24S4/c15-13(17-11-7-3-1-4-8-11)14(16)18-12-9-5-2-6-10-12/h11-12,15-16H,1-10H2 |
| InChIKey | JHCVNURKHVUQPG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|