About S-cyclohexyl 2-sulfanylbenzenecarbothioate
S-cyclohexyl 2-sulfanylbenzenecarbothioate (PubChem CID 87473649) has the molecular formula C13H16OS2
and a molecular weight of 252.40 g/mol. Its IUPAC name is S-cyclohexyl 2-sulfanylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-cyclohexyl 2-sulfanylbenzenecarbothioate |
| PubChem CID | 87473649 |
| Molecular Formula | C13H16OS2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | S-cyclohexyl 2-sulfanylbenzenecarbothioate |
| SMILES | O=C(SC1CCCCC1)c1ccccc1S |
| InChI | InChI=1S/C13H16OS2/c14-13(11-8-4-5-9-12(11)15)16-10-6-2-1-3-7-10/h4-5,8-10,15H,1-3,6-7H2 |
| InChIKey | DIGBBUWBZMVHSE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-cyclohexyl 2-sulfanylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyclohexyl 2-sulfanylbenzenecarbothioate?
The IUPAC name of S-cyclohexyl 2-sulfanylbenzenecarbothioate (CID 87473649) is S-cyclohexyl 2-sulfanylbenzenecarbothioate.
What is the SMILES notation for S-cyclohexyl 2-sulfanylbenzenecarbothioate?
The canonical SMILES for S-cyclohexyl 2-sulfanylbenzenecarbothioate is O=C(SC1CCCCC1)c1ccccc1S.
What is the InChIKey of S-cyclohexyl 2-sulfanylbenzenecarbothioate?
The InChIKey is DIGBBUWBZMVHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16OS2/c14-13(11-8-4-5-9-12(11)15)16-10-6-2-1-3-7-10/h4-5,8-10,15H,1-3,6-7H2.
What are the key properties of S-cyclohexyl 2-sulfanylbenzenecarbothioate?
S-cyclohexyl 2-sulfanylbenzenecarbothioate has a molecular weight of 252.40 g/mol, XLogP of 4.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyclohexyl 2-sulfanylbenzenecarbothioate is sourced from PubChem (CID 87473649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).