About cycloheptyl carbamimidothioate
cycloheptyl carbamimidothioate (PubChem CID 82935855) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is cycloheptyl carbamimidothioate.
Molecular Properties
| Compound Name | cycloheptyl carbamimidothioate |
| PubChem CID | 82935855 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | cycloheptyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC1CCCCCC1 |
| InChI | InChI=1S/C8H16N2S/c9-8(10)11-7-5-3-1-2-4-6-7/h7H,1-6H2,(H3,9,10) |
| InChIKey | OIUZOQPVRAUIEG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cycloheptyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl carbamimidothioate?
The IUPAC name of cycloheptyl carbamimidothioate (CID 82935855) is cycloheptyl carbamimidothioate.
What is the SMILES notation for cycloheptyl carbamimidothioate?
The canonical SMILES for cycloheptyl carbamimidothioate is [H]/N=C(\N)SC1CCCCCC1.
What is the InChIKey of cycloheptyl carbamimidothioate?
The InChIKey is OIUZOQPVRAUIEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c9-8(10)11-7-5-3-1-2-4-6-7/h7H,1-6H2,(H3,9,10).
What are the key properties of cycloheptyl carbamimidothioate?
cycloheptyl carbamimidothioate has a molecular weight of 172.30 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl carbamimidothioate is sourced from PubChem (CID 82935855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).