About cyclohexyl carbamimidothioate;oxalonitrile
cyclohexyl carbamimidothioate;oxalonitrile (PubChem CID 162013325) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is cyclohexyl carbamimidothioate;oxalonitrile.
Molecular Properties
| Compound Name | cyclohexyl carbamimidothioate;oxalonitrile |
| PubChem CID | 162013325 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | cyclohexyl carbamimidothioate;oxalonitrile |
| SMILES | N#CC#N.[H]/N=C(\N)SC1CCCCC1 |
| InChI | InChI=1S/C7H14N2S.C2N2/c8-7(9)10-6-4-2-1-3-5-6;3-1-2-4/h6H,1-5H2,(H3,8,9); |
| InChIKey | YTTQVZLHXBSUPH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl carbamimidothioate;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl carbamimidothioate;oxalonitrile?
The IUPAC name of cyclohexyl carbamimidothioate;oxalonitrile (CID 162013325) is cyclohexyl carbamimidothioate;oxalonitrile.
What is the SMILES notation for cyclohexyl carbamimidothioate;oxalonitrile?
The canonical SMILES for cyclohexyl carbamimidothioate;oxalonitrile is N#CC#N.[H]/N=C(\N)SC1CCCCC1.
What is the InChIKey of cyclohexyl carbamimidothioate;oxalonitrile?
The InChIKey is YTTQVZLHXBSUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S.C2N2/c8-7(9)10-6-4-2-1-3-5-6;3-1-2-4/h6H,1-5H2,(H3,8,9);.
What are the key properties of cyclohexyl carbamimidothioate;oxalonitrile?
cyclohexyl carbamimidothioate;oxalonitrile has a molecular weight of 210.31 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl carbamimidothioate;oxalonitrile is sourced from PubChem (CID 162013325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).