About (2-methoxycyclopentyl) carbamimidothioate
(2-methoxycyclopentyl) carbamimidothioate (PubChem CID 130587171) has the molecular formula C7H14N2OS
and a molecular weight of 174.27 g/mol. Its IUPAC name is (2-methoxycyclopentyl) carbamimidothioate.
Molecular Properties
| Compound Name | (2-methoxycyclopentyl) carbamimidothioate |
| PubChem CID | 130587171 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (2-methoxycyclopentyl) carbamimidothioate |
| SMILES | [H]/N=C(\N)SC1CCCC1OC |
| InChI | InChI=1S/C7H14N2OS/c1-10-5-3-2-4-6(5)11-7(8)9/h5-6H,2-4H2,1H3,(H3,8,9) |
| InChIKey | HVTJEOWUJFMEOC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxycyclopentyl) carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxycyclopentyl) carbamimidothioate?
The IUPAC name of (2-methoxycyclopentyl) carbamimidothioate (CID 130587171) is (2-methoxycyclopentyl) carbamimidothioate.
What is the SMILES notation for (2-methoxycyclopentyl) carbamimidothioate?
The canonical SMILES for (2-methoxycyclopentyl) carbamimidothioate is [H]/N=C(\N)SC1CCCC1OC.
What is the InChIKey of (2-methoxycyclopentyl) carbamimidothioate?
The InChIKey is HVTJEOWUJFMEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2OS/c1-10-5-3-2-4-6(5)11-7(8)9/h5-6H,2-4H2,1H3,(H3,8,9).
What are the key properties of (2-methoxycyclopentyl) carbamimidothioate?
(2-methoxycyclopentyl) carbamimidothioate has a molecular weight of 174.27 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxycyclopentyl) carbamimidothioate is sourced from PubChem (CID 130587171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).